7-(3-methylbut-2-enyl)purin-6-amine
7-(3-methylbut-2-enyl)purin-6-amine structure
|
Common Name | 7-(3-methylbut-2-enyl)purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 520-54-7 | Molecular Weight | 203.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 7-(3-methylbut-2-enyl)purin-6-amine is 7-(3-methylbut-2-enyl)purin-6-amine, with CAS number 520-54-7, molecular formula C10H13N5, and molecular weight 203.24400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(3-methylbut-2-enyl)purin-6-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13N5 |
|---|---|
| Molecular Weight | 203.24400 |
| Exact Mass | 203.11700 |
| PSA | 69.62000 |
| LogP | 1.95590 |
| InChIKey | QMJOEWBOCAQPCN-UHFFFAOYSA-N |
| SMILES | CC(C)=CCn1cnc2ncnc(N)c21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:13532-34-8
CAS#:4121-39-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| unii-299a0p8472 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: Molecular formula of 7-(3-methylbut-2-enyl)purin-6-amine is C10H13N5. |
| Q: What English synonyms does 7-(3-methylbut-2-enyl)purin-6-amine have? |
| A: English synonyms of 7-(3-methylbut-2-enyl)purin-6-amine: unii-299a0p8472. |
| Q: What is the LogP of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: LogP of 7-(3-methylbut-2-enyl)purin-6-amine is 1.95590. |
| Q: What is the CAS number of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: CAS number of 7-(3-methylbut-2-enyl)purin-6-amine is 520-54-7. |
| Q: What is the English name of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: The English name of 7-(3-methylbut-2-enyl)purin-6-amine is 7-(3-methylbut-2-enyl)purin-6-amine. |
| Q: What is the polar surface area (PSA) of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: Polar surface area (PSA) of 7-(3-methylbut-2-enyl)purin-6-amine is 69.62000. |
| Q: What is the InChIKey of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: InChIKey of 7-(3-methylbut-2-enyl)purin-6-amine is QMJOEWBOCAQPCN-UHFFFAOYSA-N. |
| Q: What are the downstream products of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: Related downstream products(CAS) of 7-(3-methylbut-2-enyl)purin-6-amine: 13532-34-8;4121-39-5. |
| Q: What is the SMILES notation of 7-(3-methylbut-2-enyl)purin-6-amine? |
| A: SMILES notation of 7-(3-methylbut-2-enyl)purin-6-amine is CC(C)=CCn1cnc2ncnc(N)c21. |
| Q: What is the Chinese name of 520-54-7? |
| A: Chinese name of 520-54-7 is 520-54-7. |