Senecionan-11,16-dione, 1,2-dihydro-2,12-dihydroxy-, (1alpha,2alpha)
Modify Date: 2025-08-20 13:39:27
Senecionan-11,16-dione, 1,2-dihydro-2,12-dihydroxy-, (1alpha,2alpha) structure
|
Common Name | Senecionan-11,16-dione, 1,2-dihydro-2,12-dihydroxy-, (1alpha,2alpha) | ||
|---|---|---|---|---|
| CAS Number | 520-65-0 | Molecular Weight | 353.41000 | |
| Density | 1.29g/cm3 | Boiling Point | 579.7ºC at 760 mmHg | |
| Molecular Formula | C18H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.4ºC | |
| Name | Rosmarinine |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 579.7ºC at 760 mmHg |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.41000 |
| Flash Point | 304.4ºC |
| Exact Mass | 353.18400 |
| PSA | 96.30000 |
| LogP | 0.18140 |
| Index of Refraction | 1.57 |
| InChIKey | YEXVXKIMPBHRQR-JDDRFXMDSA-N |
| SMILES | CC=C1CC(C)C(C)(O)C(=O)OCC2C(O)CN3CCC(OC1=O)C23 |
|
~%
Senecionan-11,1... CAS#:520-65-0 |
| Literature: Kunec, Ellen K.; Robins, David J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 1437 - 1441 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |