2-hydroxyethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate structure
|
Common Name | 2-hydroxyethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 52002-56-9 | Molecular Weight | 372.45300 | |
| Density | N/A | Boiling Point | 155ºC at 760 mmHg | |
| Molecular Formula | C19H32O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 44.4ºC | |
| Name | 2-hydroxyethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate,2-methylpropyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 155ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.45300 |
| Flash Point | 44.4ºC |
| Exact Mass | 372.21500 |
| PSA | 99.13000 |
| LogP | 2.59520 |
| InChIKey | QYHYXQCLPZLXTB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCC(C)C.C=C(C)C(=O)OCCO |
| 2-Hydroxyethyl methacrylate,methyl methacrylate,isobutyl methacrylate polymer |
| 2-Propenoic acid,2-methyl-,2-hydroxyethyl ester,polymer with methyl 2-methyl-2-propenoate and 2-methylpropyl 2-methyl-2-propenoate |