propane-1,1,2-tricarboxylic acid trimethyl ester
Modify Date: 2026-07-18 11:56:08
propane-1,1,2-tricarboxylic acid trimethyl ester structure
|
Common Name | propane-1,1,2-tricarboxylic acid trimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 52003-37-9 | Molecular Weight | 218.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | propane-1,1,2-tricarboxylic acid trimethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14O6 |
|---|---|
| Molecular Weight | 218.20400 |
| Exact Mass | 218.07900 |
| PSA | 78.90000 |
| InChIKey | PFZGFTYSHWPSLD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)C(C(=O)OC)C(=O)OC |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propan-1,1,2-tricarbonsaeure-trimethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: CAS number of propane-1,1,2-tricarboxylic acid trimethyl ester is 52003-37-9. |
| Q: What is the polar surface area (PSA) of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: Polar surface area (PSA) of propane-1,1,2-tricarboxylic acid trimethyl ester is 78.90000. |
| Q: What is the SMILES notation of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: SMILES notation of propane-1,1,2-tricarboxylic acid trimethyl ester is COC(=O)C(C)C(C(=O)OC)C(=O)OC. |
| Q: What is the molecular formula of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: Molecular formula of propane-1,1,2-tricarboxylic acid trimethyl ester is C9H14O6. |
| Q: What is the InChIKey of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: InChIKey of propane-1,1,2-tricarboxylic acid trimethyl ester is PFZGFTYSHWPSLD-UHFFFAOYSA-N. |
| Q: What is the English name of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: The English name of propane-1,1,2-tricarboxylic acid trimethyl ester is propane-1,1,2-tricarboxylic acid trimethyl ester. |
| Q: What English synonyms does propane-1,1,2-tricarboxylic acid trimethyl ester have? |
| A: English synonyms of propane-1,1,2-tricarboxylic acid trimethyl ester: Propan-1,1,2-tricarbonsaeure-trimethylester. |
| Q: What is the Chinese name of 52003-37-9? |
| A: Chinese name of 52003-37-9 is 52003-37-9. |
| Q: What is the molecular weight of propane-1,1,2-tricarboxylic acid trimethyl ester? |
| A: Molecular weight of propane-1,1,2-tricarboxylic acid trimethyl ester is 218.20400. |