(4-Methoxy-[1,1'-biphenyl]-2-yl)methanol
Modify Date: 2026-08-15 18:02:36
![(4-Methoxy-[1,1'-biphenyl]-2-yl)methanol Structure](https://www.chemsrc.com/extcaspic/059/52008-92-1.png)
(4-Methoxy-[1,1'-biphenyl]-2-yl)methanol structure
|
Common Name | (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 52008-92-1 | Molecular Weight | 214.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O2 |
|---|---|
| Molecular Weight | 214.26 |
| InChIKey | JUGLHYPHNUYNBA-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccccc2)c(CO)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 52008-92-1? |
| A: Chinese name of 52008-92-1 is 52008-92-1. |
| Q: What is the molecular formula of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: Molecular formula of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is C14H14O2. |
| Q: What is the InChIKey of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: InChIKey of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is JUGLHYPHNUYNBA-UHFFFAOYSA-N. |
| Q: What is the CAS number of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: CAS number of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is 52008-92-1. |
| Q: What is the molecular weight of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: Molecular weight of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is 214.26. |
| Q: What is the English name of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: The English name of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol. |
| Q: What is the SMILES notation of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol? |
| A: SMILES notation of (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol is COc1ccc(-c2ccccc2)c(CO)c1. |