benzyl 2-amino-2-diethoxyphosphorylacetate
benzyl 2-amino-2-diethoxyphosphorylacetate structure
|
Common Name | benzyl 2-amino-2-diethoxyphosphorylacetate | ||
|---|---|---|---|---|
| CAS Number | 52039-22-2 | Molecular Weight | 301.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 2-amino-2-diethoxyphosphorylacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20NO5P |
|---|---|
| Molecular Weight | 301.27500 |
| Exact Mass | 301.10800 |
| PSA | 97.66000 |
| LogP | 2.98100 |
| InChIKey | SILAHJPKKUNWKQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(N)C(=O)OCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![Benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate structure](https://image.chemsrc.com/caspic/488/54244-69-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetic acid,amino(diethoxyphosphinyl)-,phenylmethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: InChIKey of benzyl 2-amino-2-diethoxyphosphorylacetate is SILAHJPKKUNWKQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: CAS number of benzyl 2-amino-2-diethoxyphosphorylacetate is 52039-22-2. |
| Q: What is the English name of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: The English name of benzyl 2-amino-2-diethoxyphosphorylacetate is benzyl 2-amino-2-diethoxyphosphorylacetate. |
| Q: What is the Chinese name of 52039-22-2? |
| A: Chinese name of 52039-22-2 is 52039-22-2. |
| Q: What English synonyms does benzyl 2-amino-2-diethoxyphosphorylacetate have? |
| A: English synonyms of benzyl 2-amino-2-diethoxyphosphorylacetate: Acetic acid,amino(diethoxyphosphinyl)-,phenylmethyl ester. |
| Q: What is the LogP of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: LogP of benzyl 2-amino-2-diethoxyphosphorylacetate is 2.98100. |
| Q: What are the upstream materials of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: Related upstream materials(CAS) of benzyl 2-amino-2-diethoxyphosphorylacetate: 54244-69-8;100-39-0;55601-40-6;122-51-0;7396-44-3. |
| Q: What is the SMILES notation of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: SMILES notation of benzyl 2-amino-2-diethoxyphosphorylacetate is CCOP(=O)(OCC)C(N)C(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: Polar surface area (PSA) of benzyl 2-amino-2-diethoxyphosphorylacetate is 97.66000. |
| Q: What is the molecular weight of benzyl 2-amino-2-diethoxyphosphorylacetate? |
| A: Molecular weight of benzyl 2-amino-2-diethoxyphosphorylacetate is 301.27500. |