Diproxadol structure
|
Common Name | Diproxadol | ||
|---|---|---|---|---|
| CAS Number | 52042-24-7 | Molecular Weight | 271.69700 | |
| Density | 1.384g/cm3 | Boiling Point | 571.5ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.4ºC | |
| Name | 6-chloro-4-(2,3-dihydroxypropyl)-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 571.5ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.69700 |
| Flash Point | 299.4ºC |
| Exact Mass | 271.06100 |
| PSA | 70.00000 |
| LogP | 0.87210 |
| Index of Refraction | 1.584 |
| InChIKey | YIAHFLWLLVEPPS-UHFFFAOYSA-N |
| SMILES | CC1Oc2ccc(Cl)cc2N(CC(O)CO)C1=O |
| HS Code | 2934999090 |
|---|
|
~%
Diproxadol CAS#:52042-24-7 |
| Literature: Thuillier; Laforest; Bessin; et al. European Journal of Medicinal Chemistry, 1975 , vol. 10, # 1 p. 37 - 42 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-4-(2,3-dihydroxypropyl)-2-methyl-2H-1,4-benzoxazin-3(4H)-one |
| 2H-1,4-Benzoxazin-3(4H)-one,6-chloro-4-(2,3-dihydroxypropyl)-2-methyl |
| Diproxadol |
| Diproxadol [INN] |
| 2-Methyl-3-oxo-4-(2,3-dihydroxypropyl)-6-chloro-2,3-dihydro-1,4-benzoxazine |
| Diproxadolum |
| Diproxadolum [INN-Latin] |