Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate structure
|
Common Name | Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 52047-13-9 | Molecular Weight | 252.01200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Cl2N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3Cl2N3O4 |
|---|---|
| Molecular Weight | 252.01200 |
| Exact Mass | 250.95000 |
| PSA | 97.90000 |
| LogP | 2.00140 |
| InChIKey | QOZVZJLPNJOHFA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc(Cl)nc(Cl)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
|
~90%
Methyl 2,6-dich... CAS#:52047-13-9 |
| Literature: Thurston, David E.; Bose, D. Subhas; Howard, Philip W.; Jenkins, Terence C.; Leoni, Alberto; Baraldi, Pier G.; Guiotto, Andrea; Cacciari, Barbara; Kelland, Lloyd R.; Foloppe, Marie-Paule; Rault, Sylvain Journal of Medicinal Chemistry, 1999 , vol. 42, # 11 p. 1951 - 1964 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| qc-753 |