(tricyclo[3.3.1.13,7]decane-1,3-diyldiethane-2,1-diylbis[trichlorosilane] structure
|
Common Name | (tricyclo[3.3.1.13,7]decane-1,3-diyldiethane-2,1-diylbis[trichlorosilane] | ||
|---|---|---|---|---|
| CAS Number | 52057-53-1 | Molecular Weight | 459.21300 | |
| Density | 1.335g/cm3 | Boiling Point | 408ºC at 760 mmHg | |
| Molecular Formula | C14H22Cl6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | trichloro-[2-[3-(2-trichlorosilylethyl)-1-adamantyl]ethyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 408ºC at 760 mmHg |
| Molecular Formula | C14H22Cl6Si2 |
| Molecular Weight | 459.21300 |
| Flash Point | 185.2ºC |
| Exact Mass | 455.93900 |
| LogP | 7.66380 |
| Index of Refraction | 1.535 |
| InChIKey | FBAPGRJUUVOMGN-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCC12CC3CC(C1)CC(CC[Si](Cl)(Cl)Cl)(C3)C2 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (Tricyclo(3.3.1.13,7)decane-1,3-diyldiethane-2,1-diyl)bis(trichlorosilane) |
| Tricyclo(3.3.1.13,7)decane,1,3-bis(2-(trichlorosilyl)ethyl) |
| 1,3-Bis(2(trichlorosilyl)ethyl)adamantane |
| Silane,(tricyclo(3.3.1.13,7)decane-1,3-diyldi-2,1-ethanediyl)bis(trichloro |
| EINECS 257-628-5 |