2-(1-adamantyl)ethyl-trimethylsilane
Modify Date: 2025-08-26 10:43:51
2-(1-adamantyl)ethyl-trimethylsilane structure
|
Common Name | 2-(1-adamantyl)ethyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 52057-55-3 | Molecular Weight | 236.46800 | |
| Density | 0.919g/cm3 | Boiling Point | 280.2ºC at 760 mmHg | |
| Molecular Formula | C15H28Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.2ºC | |
| Name | 2-(1-adamantyl)ethyl-trimethylsilane |
|---|
| Density | 0.919g/cm3 |
|---|---|
| Boiling Point | 280.2ºC at 760 mmHg |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.46800 |
| Flash Point | 108.2ºC |
| Exact Mass | 236.19600 |
| LogP | 4.93110 |
| Index of Refraction | 1.488 |
| InChIKey | FWEZHKSBOVXAIU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCC12CC3CC(CC(C3)C1)C2 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |