1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene
![1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene Structure](https://image.chemsrc.com/caspic/313/52082-75-4.png)
1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene structure
|
Common Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 52082-75-4 | Molecular Weight | 430.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12F10S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12F10S3 |
|---|---|
| Molecular Weight | 430.30700 |
| Exact Mass | 429.90000 |
| PSA | 75.90000 |
| LogP | 6.52520 |
| InChIKey | WAWDZKHAORKCNL-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(SSSc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:15607-89-3
CAS#:40779-99-5
CAS#:25030-42-6
CAS#:13780-57-9
CAS#:771-62-0
CAS#:21459-27-8
CAS#:344-07-0
CAS#:62098-19-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Trisulfide,bis(pentafluorophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: LogP of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is 6.52520. |
| Q: What is the CAS number of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: CAS number of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is 52082-75-4. |
| Q: What is the SMILES notation of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: SMILES notation of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is Fc1c(F)c(F)c(SSSc2c(F)c(F)c(F)c(F)c2F)c(F)c1F. |
| Q: What is the InChIKey of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: InChIKey of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is WAWDZKHAORKCNL-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: Related upstream materials(CAS) of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene: 15607-89-3;40779-99-5;25030-42-6;13780-57-9;771-62-0;21459-27-8;344-07-0;62098-19-5. |
| Q: What English synonyms does 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene have? |
| A: English synonyms of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene: Trisulfide,bis(pentafluorophenyl). |
| Q: What is the polar surface area (PSA) of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: Polar surface area (PSA) of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is 75.90000. |
| Q: What is the molecular weight of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: Molecular weight of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is 430.30700. |
| Q: What is the English name of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: The English name of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene. |
| Q: What is the molecular formula of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene? |
| A: Molecular formula of 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)trisulfanyl]benzene is C12F10S3. |