1,3-dioxo-1H,3H-naphtho[1,8-cd]pyran-6-sulphonic acid structure
|
Common Name | 1,3-dioxo-1H,3H-naphtho[1,8-cd]pyran-6-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 52083-12-2 | Molecular Weight | 278.23700 | |
| Density | 1.744g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H6O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dioxo-1h,3h-benzo[de]isochromene-6-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.744g/cm3 |
|---|---|
| Molecular Formula | C12H6O6S |
| Molecular Weight | 278.23700 |
| Exact Mass | 277.98900 |
| PSA | 106.12000 |
| LogP | 2.47790 |
| Index of Refraction | 1.732 |
| InChIKey | HOMQUHGCYPKWEY-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2ccc(S(=O)(=O)O)c3cccc1c23 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 257-647-9 |