1-(6-amino-1,2-dihydroacenaphthylen-5-yl)ethanone structure
|
Common Name | 1-(6-amino-1,2-dihydroacenaphthylen-5-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 5209-01-8 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(6-amino-1,2-dihydroacenaphthylen-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 43.09000 |
| LogP | 3.30440 |
| InChIKey | DDYLMTWTJIVUDQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c3c(ccc(N)c13)CC2 |
| HS Code | 2922399090 |
|---|
|
~90%
1-(6-amino-1,2-... CAS#:5209-01-8 |
| Literature: Mezheritskii; Antonov; Milov; Lysenko Russian Journal of Organic Chemistry, 2010 , vol. 46, # 6 p. 844 - 854 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethanone,1-(6-amino-1,2-dihydro-5-acenaphthylenyl) |