[(8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate structure
|
Common Name | [(8R,9S,10R,13S,14S,17S)-3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate | ||
|---|---|---|---|---|
| CAS Number | 52091-99-3 | Molecular Weight | 372.54100 | |
| Density | 1.07g/cm3 | Boiling Point | 481.9ºC at 760 mmHg | |
| Molecular Formula | C24H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | (3-ethoxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) propanoate |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 481.9ºC at 760 mmHg |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.54100 |
| Flash Point | 207.8ºC |
| Exact Mass | 372.26600 |
| PSA | 35.53000 |
| LogP | 5.80130 |
| Index of Refraction | 1.536 |
| InChIKey | NULCEDVSYYAIBD-CGRIZKAYSA-N |
| SMILES | CCOC1=CC2=CCC3C(CCC4(C)C(OC(=O)CC)CCC34)C2(C)CC1 |
|
~%
[(8R,9S,10R,13S... CAS#:52091-99-3 |
| Literature: Schwenk; Fleischer; Whitman Journal of the American Chemical Society, 1938 , vol. 60, p. 1702 |
|
~%
[(8R,9S,10R,13S... CAS#:52091-99-3 |
| Literature: Ercoli; Ruggieri Journal of the American Chemical Society, 1953 , vol. 75, p. 650,652 |
|
~%
[(8R,9S,10R,13S... CAS#:52091-99-3 |
| Literature: Lovens kem. Fabr. Patent: DE923847 , 1952 ; |