3,4-DIPHENYL-5-NITRO-2-FUROICACID structure
|
Common Name | 3,4-DIPHENYL-5-NITRO-2-FUROICACID | ||
|---|---|---|---|---|
| CAS Number | 52101-40-3 | Molecular Weight | 309.27300 | |
| Density | 1.361g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C17H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 5-nitro-3,4-diphenylfuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.27300 |
| Flash Point | 216.2ºC |
| Exact Mass | 309.06400 |
| PSA | 96.26000 |
| LogP | 4.74320 |
| Index of Refraction | 1.633 |
| InChIKey | HZKQRIMQLFWOGN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1oc([N+](=O)[O-])c(-c2ccccc2)c1-c1ccccc1 |
| HS Code | 2932190090 |
|---|
|
~92%
3,4-DIPHENYL-5-... CAS#:52101-40-3 |
| Literature: Kuo; Wu; Huang; Yamamoto; Yoshina Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 3 p. 635 - 645 |
|
~%
3,4-DIPHENYL-5-... CAS#:52101-40-3 |
| Literature: Kuo; Wu; Huang; Yamamoto; Yoshina Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 3 p. 635 - 645 |
|
~%
3,4-DIPHENYL-5-... CAS#:52101-40-3 |
| Literature: Kuo; Wu; Huang; Yamamoto; Yoshina Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 3 p. 635 - 645 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,4-Diphenyl-5-nitro-2-furoic acid |
| 2-FURANCARBOXYLIC ACID,3,4-DIPHENYL-5-NITRO |