6-methoxy-2-methylinden-1-one
6-methoxy-2-methylinden-1-one structure
|
Common Name | 6-methoxy-2-methylinden-1-one | ||
|---|---|---|---|---|
| CAS Number | 52102-75-7 | Molecular Weight | 174.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methoxy-2-methylinden-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10O2 |
|---|---|
| Molecular Weight | 174.19600 |
| Exact Mass | 174.06800 |
| PSA | 26.30000 |
| LogP | 2.29480 |
| InChIKey | KRYCZVJUJXUMLB-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)C(C)=C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-methoxy-2-met... CAS#:52102-75-7 |
| Literature: Pincock; Young Canadian Journal of Chemistry, 2003 , vol. 81, # 10 p. 1083 - 1095 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 6 | |
CAS#:71644-70-7
CAS#:85749-68-4
CAS#:646507-54-2
CAS#:646507-55-3
CAS#:646507-57-5
CAS#:646507-58-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Inden-1-one,6-methoxy-2-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6-methoxy-2-methylinden-1-one have? |
| A: English synonyms of 6-methoxy-2-methylinden-1-one: 1H-Inden-1-one,6-methoxy-2-methyl. |
| Q: What is the Chinese name of 52102-75-7? |
| A: Chinese name of 52102-75-7 is 52102-75-7. |
| Q: What is the molecular weight of 6-methoxy-2-methylinden-1-one? |
| A: Molecular weight of 6-methoxy-2-methylinden-1-one is 174.19600. |
| Q: What is the CAS number of 6-methoxy-2-methylinden-1-one? |
| A: CAS number of 6-methoxy-2-methylinden-1-one is 52102-75-7. |
| Q: What is the molecular formula of 6-methoxy-2-methylinden-1-one? |
| A: Molecular formula of 6-methoxy-2-methylinden-1-one is C11H10O2. |
| Q: What are the upstream materials of 6-methoxy-2-methylinden-1-one? |
| A: Related upstream materials(CAS) of 6-methoxy-2-methylinden-1-one: 5464-10-8. |
| Q: What is the English name of 6-methoxy-2-methylinden-1-one? |
| A: The English name of 6-methoxy-2-methylinden-1-one is 6-methoxy-2-methylinden-1-one. |
| Q: What is the SMILES notation of 6-methoxy-2-methylinden-1-one? |
| A: SMILES notation of 6-methoxy-2-methylinden-1-one is COc1ccc2c(c1)C(=O)C(C)=C2. |
| Q: What is the LogP of 6-methoxy-2-methylinden-1-one? |
| A: LogP of 6-methoxy-2-methylinden-1-one is 2.29480. |
| Q: What is the polar surface area (PSA) of 6-methoxy-2-methylinden-1-one? |
| A: Polar surface area (PSA) of 6-methoxy-2-methylinden-1-one is 26.30000. |