diethyl-methyl-(3-oxopentyl)azanium,iodide structure
|
Common Name | diethyl-methyl-(3-oxopentyl)azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 52103-30-7 | Molecular Weight | 299.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-methyl-(3-oxopentyl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22INO |
|---|---|
| Molecular Weight | 299.19200 |
| Exact Mass | 299.07500 |
| PSA | 17.07000 |
| InChIKey | MLCZZDSLFGTXBC-UHFFFAOYSA-M |
| SMILES | CCC(=O)CC[N+](C)(CC)CC.[I-] |
|
~%
diethyl-methyl-... CAS#:52103-30-7 |
| Literature: Adamson et al. Journal of the Chemical Society, 1937 , p. 1576,1579 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-Pentanaminium,N,N-diethyl-N-methyl-3-oxo-,iodide |