N-(3,4-Dichlorophenyl)-5-chloro-2-hydroxy[1,1'-biphenyl]-3-carboxamide structure
|
Common Name | N-(3,4-Dichlorophenyl)-5-chloro-2-hydroxy[1,1'-biphenyl]-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5212-99-7 | Molecular Weight | 392.66300 | |
| Density | 1.465g/cm3 | Boiling Point | 487.8ºC at 760 mmHg | |
| Molecular Formula | C19H12Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.8ºC | |
| Name | 5-chloro-N-(3,4-dichlorophenyl)-2-hydroxy-3-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 487.8ºC at 760 mmHg |
| Molecular Formula | C19H12Cl3NO2 |
| Molecular Weight | 392.66300 |
| Flash Point | 248.8ºC |
| Exact Mass | 390.99300 |
| PSA | 52.82000 |
| LogP | 6.65570 |
| Index of Refraction | 1.686 |
| InChIKey | XTQLFZDSLTWTPM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(Cl)cc(-c2ccccc2)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-CHLORO-N-(3,4-DICHLOROPHENYL)-2-HYDROXYBIPHENYL-3-CARBOXAMIDE |
| (1,1'-Biphenyl)-3-carboxamide,5-chloro-N-(3,4-dichlorophenyl)-2-hydroxy |
| OM-1460 |
| 5-Chloro-N-(3,4-dichlorophenyl)-2-hydroxy-(1,1'-biphenyl)-3-carboxamide |
| ENT 27,136 |