ethyl 2-[(2Z)-2-(furan-2-carbonylimino)-5-nitro-1,3-thiazol-3-yl]acetate structure
|
Common Name | ethyl 2-[(2Z)-2-(furan-2-carbonylimino)-5-nitro-1,3-thiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 52121-01-4 | Molecular Weight | 325.29700 | |
| Density | 1.54g/cm3 | Boiling Point | 452.7ºC at 760 mmHg | |
| Molecular Formula | C12H11N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6ºC | |
| Name | ethyl 2-[2-(furan-2-carbonylimino)-5-nitro-1,3-thiazol-3-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 452.7ºC at 760 mmHg |
| Molecular Formula | C12H11N3O6S |
| Molecular Weight | 325.29700 |
| Flash Point | 227.6ºC |
| Exact Mass | 325.03700 |
| PSA | 147.86000 |
| LogP | 1.87820 |
| Index of Refraction | 1.656 |
| InChIKey | ZQRMZCHAMAMNBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1cc([N+](=O)[O-])sc1=NC(=O)c1ccco1 |
| HS Code | 2934100090 |
|---|
|
~%
ethyl 2-[(2Z)-2... CAS#:52121-01-4 |
| Literature: Islip; Closier; Neville Journal of Medicinal Chemistry, 1974 , vol. 17, # 2 p. 207 - 209 |
|
~%
ethyl 2-[(2Z)-2... CAS#:52121-01-4 |
| Literature: Islip; Closier; Neville Journal of Medicinal Chemistry, 1974 , vol. 17, # 2 p. 207 - 209 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ethyl 2-[(2z)-2-(furan-2-carbonylimino)-5-nitro-1,3-thiazol-3-yl]acetate |