ethyl N-[2-[(2Z)-2-(ethylcarbamoylimino)-5-nitro-1,3-thiazol-3-yl]acetyl]-N-methyl-carbamate structure
|
Common Name | ethyl N-[2-[(2Z)-2-(ethylcarbamoylimino)-5-nitro-1,3-thiazol-3-yl]acetyl]-N-methyl-carbamate | ||
|---|---|---|---|---|
| CAS Number | 52121-09-2 | Molecular Weight | 359.35800 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H17N5O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[2-[2-(ethylcarbamoylimino)-5-nitro-1,3-thiazol-3-yl]acetyl]-N-methylcarbamate |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C12H17N5O6S |
| Molecular Weight | 359.35800 |
| Exact Mass | 359.09000 |
| PSA | 167.06000 |
| LogP | 1.61700 |
| Index of Refraction | 1.624 |
| InChIKey | LMZLGXWJUGZVJB-SDNWHVSQSA-N |
| SMILES | CCNC(=O)N=c1sc([N+](=O)[O-])cn1CC(=O)N(C)C(=O)OCC |
|
~%
ethyl N-[2-[(2Z... CAS#:52121-09-2 |
| Literature: Islip; Closier; Neville Journal of Medicinal Chemistry, 1974 , vol. 17, # 2 p. 207 - 209 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |