2-Nitro-5-methyl-1H-imidazole structure
|
Common Name | 2-Nitro-5-methyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 5213-35-4 | Molecular Weight | 127.10100 | |
| Density | 1.426g/cm3 | Boiling Point | 362.4ºC at 760 mmHg | |
| Molecular Formula | C4H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | 5-methyl-2-nitro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760 mmHg |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10100 |
| Flash Point | 173ºC |
| Exact Mass | 127.03800 |
| PSA | 74.50000 |
| LogP | 1.14950 |
| Index of Refraction | 1.591 |
| InChIKey | LIONKSIUQQYOMX-UHFFFAOYSA-N |
| SMILES | Cc1cnc([N+](=O)[O-])[nH]1 |
| HS Code | 2933290090 |
|---|
|
~%
2-Nitro-5-methy... CAS#:5213-35-4 |
| Literature: Davis, Dwight P.; Kirk, Kenneth L.; Cohen, Louis A. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 253 - 256 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Imidazole,5-methyl-2-nitro-,mixed with 4-methyl-2-nitroimidazole (1:1) |
| 1H-Imidazole,4-methyl-2-nitro |
| METHYLNITROIMIDAZOLE |
| 4-Methyl-2-nitroimidazole |
| IMIDAZOLE,4-METHYL-2-NITRO-,mixed with 5-METHYL-2-NITROIMIDAZOLE (1:1) |