H-Tyr(Bzl)-ObzlHCl structure
|
Common Name | H-Tyr(Bzl)-ObzlHCl | ||
|---|---|---|---|---|
| CAS Number | 52142-01-5 | Molecular Weight | 397.895 | |
| Density | N/A | Boiling Point | 538.5ºC at 760 mmHg | |
| Molecular Formula | C23H24ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 538.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.895 |
| Flash Point | 279.5ºC |
| Exact Mass | 397.144470 |
| PSA | 61.55000 |
| LogP | 5.38110 |
| InChIKey | DYLKTBYVTWFYGQ-FTBISJDPSA-N |
| SMILES | Cl.NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)OCc1ccccc1 |
| Storage condition | Store at 0-5°C |
| HS Code | 2922509090 |
|---|
|
~98%
H-Tyr(Bzl)-ObzlHCl CAS#:52142-01-5 |
| Literature: Ikeda, Kiyoshi; Miyajima, Keisuke; Maruyama, Yasufumi; Achiwa, Kazuo Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 4 p. 563 - 568 |
|
~%
H-Tyr(Bzl)-ObzlHCl CAS#:52142-01-5 |
| Literature: Ikeda, Kiyoshi; Miyajima, Keisuke; Maruyama, Yasufumi; Achiwa, Kazuo Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 4 p. 563 - 568 |
|
~%
H-Tyr(Bzl)-ObzlHCl CAS#:52142-01-5 |
| Literature: Ikeda, Kiyoshi; Miyajima, Keisuke; Maruyama, Yasufumi; Achiwa, Kazuo Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 4 p. 563 - 568 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Tyr(OCH2Ph)CH2Ph hydrochloride |
| Benzyl O-benzyl-L-tyrosinate hydrochloride (1:1) |
| L-Tyr(CH2Ph)-OCH2Ph hydrochloride |
| L-Tyrosine, O-(phenylmethyl)-, phenylmethyl ester, hydrochloride (1:1) |
| H-Tyr(Bzl)-OBzlHCl |
| O-Benzyl-L-tyrosin-benzylester,Hydrochlorid |
| O-Benzyl-L-tyrosine benzyl ester hydrochloride |
| MFCD00153465 |
| H-Tyr(Bzl)-OBzl·HCl |
| H-TYR(BZL)-OBZL·HCL |
| H-Tyr(Bzl)-OBzl.HCl |