2-(4-nitrophenyl)ethenesulfonamide
Modify Date: 2025-08-25 10:22:28
2-(4-nitrophenyl)ethenesulfonamide structure
|
Common Name | 2-(4-nitrophenyl)ethenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 52147-91-8 | Molecular Weight | 228.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-nitrophenyl)ethenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O4S |
|---|---|
| Molecular Weight | 228.22500 |
| Exact Mass | 228.02000 |
| PSA | 114.36000 |
| LogP | 3.15830 |
| InChIKey | AAWSZAQEVCTOLT-AATRIKPKSA-N |
| SMILES | NS(=O)(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
|
~%
2-(4-nitropheny... CAS#:52147-91-8 |
| Literature: Bordwell; Colbert; Alan Journal of the American Chemical Society, 1946 , vol. 68, p. 1778,1781 |
|
~%
2-(4-nitropheny... CAS#:52147-91-8 |
| Literature: Bordwell; Colbert; Alan Journal of the American Chemical Society, 1946 , vol. 68, p. 1778,1781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethenesulfonamide,2-(4-nitrophenyl)-,(E) |