2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone
![2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone Structure](https://image.chemsrc.com/caspic/489/52154-24-2.png)
2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone structure
|
Common Name | 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 52154-24-2 | Molecular Weight | 258.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-[(R)-(4-Methylphenyl)sulfinyl]-1-phenylethanone (CAS number: 52154-24-2, molecular formula: C15H14O2S, molecular weight: 258.33500), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O2S |
|---|---|
| Molecular Weight | 258.33500 |
| Exact Mass | 258.07100 |
| PSA | 53.35000 |
| LogP | 3.85120 |
| InChIKey | JQIQTCZCJCVZOX-GOSISDBHSA-N |
| SMILES | Cc1ccc(S(=O)CC(=O)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 3 | |
CAS#:83859-18-1![2-[(4-methylphenyl)sulfanyl]-1-phenylethanone Structure](https://image.chemsrc.com/caspic/165/33046-45-6.png)
CAS#:33046-45-6
CAS#:934-72-5
CAS#:93-89-0
CAS#:1519-39-7
CAS#:100-47-0
CAS#:13466-32-5
CAS#:1517-82-4
CAS#:1445-91-6
CAS#:20780-54-5
CAS#:20780-53-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanone,2-[(R)-(4-methylphenyl)sulfinyl]-1-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: Related downstream products(CAS) of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone: 1445-91-6;20780-54-5;20780-53-4. |
| Q: What is the InChIKey of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: InChIKey of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is JQIQTCZCJCVZOX-GOSISDBHSA-N. |
| Q: What is the English name of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: The English name of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone. |
| Q: What is the SMILES notation of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: SMILES notation of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is Cc1ccc(S(=O)CC(=O)c2ccccc2)cc1. |
| Q: What is the molecular weight of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: Molecular weight of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is 258.33500. |
| Q: What is the polar surface area (PSA) of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: Polar surface area (PSA) of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is 53.35000. |
| Q: What English synonyms does 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone have? |
| A: English synonyms of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone: Ethanone,2-[(R)-(4-methylphenyl)sulfinyl]-1-phenyl. |
| Q: What is the LogP of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: LogP of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is 3.85120. |
| Q: What is the Chinese name of 52154-24-2? |
| A: Chinese name of 52154-24-2 is 52154-24-2. |
| Q: What is the CAS number of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone? |
| A: CAS number of 2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanone is 52154-24-2. |