N-[4-(2,3-dichloroanilino)pyridin-3-yl]sulfonylacetamide structure
|
Common Name | N-[4-(2,3-dichloroanilino)pyridin-3-yl]sulfonylacetamide | ||
|---|---|---|---|---|
| CAS Number | 52158-05-1 | Molecular Weight | 360.21600 | |
| Density | 1.521g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(2,3-dichloroanilino)pyridin-3-yl]sulfonylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.21600 |
| Exact Mass | 358.99000 |
| PSA | 103.26000 |
| LogP | 4.29980 |
| Index of Refraction | 1.631 |
| InChIKey | VOBMKFCGQITVFG-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1cnccc1Nc1cccc(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-((4-((2,3-Dichlorophenyl)amino)-3-pyridinyl)sulfonyl)acetamide |
| N-((4-((2,3-DICHLOROPHENYL)AMINO)-PYRIDIN-3-YL)SULFONYL)ACETAMIDE |
| Acetamide,N-((4-((2,3-dichlorophenyl)amino)-3-pyridinyl)sulfonyl) |
| JDL 255 |
| LS-8906 |