(Z)-α,β-Dichlorostilbene structure
|
Common Name | (Z)-α,β-Dichlorostilbene | ||
|---|---|---|---|---|
| CAS Number | 5216-32-0 | Molecular Weight | 287.74100 | |
| Density | 1.26g/cm3 | Boiling Point | 364.3ºC at 760 mmHg | |
| Molecular Formula | C16H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | N-(4-chloro-2-propanoylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 364.3ºC at 760 mmHg |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.74100 |
| Flash Point | 174.1ºC |
| Exact Mass | 287.07100 |
| PSA | 49.66000 |
| LogP | 4.56900 |
| Index of Refraction | 1.621 |
| InChIKey | RZTUSZRHPIQREQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(Cl)ccc1NC(=O)c1ccccc1 |
| HS Code | 2903999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| N-(4-chloro-2-propanoyl-phenyl)benzamide |