1-bromo-4-[1-(4-bromophenyl)-2-chloro-ethyl]benzene structure
|
Common Name | 1-bromo-4-[1-(4-bromophenyl)-2-chloro-ethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 5216-52-4 | Molecular Weight | 374.49800 | |
| Density | 1.629g/cm3 | Boiling Point | 432.4ºC at 760 mmHg | |
| Molecular Formula | C14H11Br2Cl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | 1-bromo-4-[1-(4-bromophenyl)-2-chloroethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.629g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760 mmHg |
| Molecular Formula | C14H11Br2Cl |
| Molecular Weight | 374.49800 |
| Flash Point | 239.1ºC |
| Exact Mass | 371.89200 |
| LogP | 5.58230 |
| Index of Refraction | 1.617 |
| InChIKey | IVZSOMYJMXCGLE-UHFFFAOYSA-N |
| SMILES | ClCC(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| HS Code | 2903999090 |
|---|
|
~%
1-bromo-4-[1-(4... CAS#:5216-52-4 |
| Literature: Cristol et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3333,3337 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-(2-chloroethane-1,1-diyl)bis(4-bromobenzene) |