N-(6-chloro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide structure
|
Common Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 5217-17-4 | Molecular Weight | 378.87500 | |
| Density | 1.373g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
|---|
| Density | 1.373g/cm3 |
|---|---|
| Molecular Formula | C21H15ClN2OS |
| Molecular Weight | 378.87500 |
| Exact Mass | 378.05900 |
| PSA | 73.72000 |
| LogP | 6.36980 |
| Index of Refraction | 1.717 |
| InChIKey | LJUWEHZNYUKTAQ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)C(c1ccccc1)c1ccccc1 |
|
~%
N-(6-chloro-1,3... CAS#:5217-17-4 |
| Literature: Gascoigne et al. Journal of the Chemical Society, 1951 , p. 2346,2351 |