2-Chloro-4,6-bis(methoxy(methyl)amino)-1,3,5-triazine structure
|
Common Name | 2-Chloro-4,6-bis(methoxy(methyl)amino)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 5217-83-4 | Molecular Weight | 233.65500 | |
| Density | 1.3g/cm3 | Boiling Point | 481ºC at 760 mmHg | |
| Molecular Formula | C7H12ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
| Name | 6-chloro-2-N,4-N-dimethoxy-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 481ºC at 760 mmHg |
| Molecular Formula | C7H12ClN5O2 |
| Molecular Weight | 233.65500 |
| Flash Point | 244.7ºC |
| Exact Mass | 233.06800 |
| PSA | 63.61000 |
| LogP | 0.52020 |
| Index of Refraction | 1.576 |
| InChIKey | NQHMHMFLZWVSDH-UHFFFAOYSA-N |
| SMILES | CON(C)c1nc(Cl)nc(N(C)OC)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |