1,1'-[methylenebis(oxy)]bis[2,4,6-tribromobenzene] structure
|
Common Name | 1,1'-[methylenebis(oxy)]bis[2,4,6-tribromobenzene] | ||
|---|---|---|---|---|
| CAS Number | 52176-20-2 | Molecular Weight | 673.61000 | |
| Density | 2.414g/cm3 | Boiling Point | 560.2ºC at 760mmHg | |
| Molecular Formula | C13H6Br6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | 1,3,5-tribromo-2-[(2,4,6-tribromophenoxy)methoxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.414g/cm3 |
|---|---|
| Boiling Point | 560.2ºC at 760mmHg |
| Molecular Formula | C13H6Br6O2 |
| Molecular Weight | 673.61000 |
| Flash Point | 236ºC |
| Exact Mass | 667.54700 |
| PSA | 18.46000 |
| LogP | 7.67690 |
| Index of Refraction | 1.679 |
| InChIKey | FNXLWHARVDGLKF-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(OCOc2c(Br)cc(Br)cc2Br)c(Br)c1 |
| HS Code | 2909309090 |
|---|
|
~%
1,1'-[methylene... CAS#:52176-20-2 |
| Literature: Auwers; Sigel Chemische Berichte, 1902 , vol. 35, p. 434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 257-704-8 |
| 1,1'-[methylenebis(oxy)]bis(2,4,6-tribromobenzene) |