1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one
1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one structure
|
Common Name | 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 52182-26-0 | Molecular Weight | 252.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one, also known as O-(3-methoxyphenyl)-N-(4-methylphenyl)propenamide, with CAS number 52182-26-0, molecular formula C17H16O2, and molecular weight 252.31. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.30800 |
| Exact Mass | 252.11500 |
| PSA | 26.30000 |
| LogP | 3.89970 |
| InChIKey | NHORRVWNYQDPID-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)C=Cc2ccc(C)cc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(3-methoxyphe... CAS#:52182-26-0 |
| Literature: Walton, Jeffrey G. A.; Jones, Deuan C.; Kiuru, Paula; Durie, Alastair J.; Westwood, Nicholas J.; Fairlamb, Alan H. ChemMedChem, 2011 , vol. 6, # 2 p. 321 - 328 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:898768-51-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propen-1-one,1-(3-methoxyphenyl)-3-(4-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is 26.30000. |
| Q: What are the downstream products of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: Related downstream products(CAS) of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one: 898768-51-9. |
| Q: What is the CAS number of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: CAS number of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is 52182-26-0. |
| Q: What is the InChIKey of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: InChIKey of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is NHORRVWNYQDPID-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: The English name of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one. |
| Q: What is the molecular formula of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: Molecular formula of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is C17H16O2. |
| Q: What English synonyms does 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one have? |
| A: English synonyms of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one: 2-Propen-1-one,1-(3-methoxyphenyl)-3-(4-methylphenyl). |
| Q: What is the Chinese name of 52182-26-0? |
| A: Chinese name of 52182-26-0 is 52182-26-0. |
| Q: What is the molecular weight of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: Molecular weight of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is 252.30800. |
| Q: What is the SMILES notation of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one? |
| A: SMILES notation of 1-(3-methoxyphenyl)-3-(4-methylphenyl)prop-2-en-1-one is COc1cccc(C(=O)C=Cc2ccc(C)cc2)c1. |