1-(benzylideneamino)-3-methyl-1-phenylurea structure
|
Common Name | 1-(benzylideneamino)-3-methyl-1-phenylurea | ||
|---|---|---|---|---|
| CAS Number | 52185-06-5 | Molecular Weight | 253.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzylideneamino)-3-methyl-1-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15N3O |
|---|---|
| Molecular Weight | 253.29900 |
| Exact Mass | 253.12200 |
| PSA | 48.19000 |
| LogP | 3.07090 |
| InChIKey | AAUNGGNBESHUTK-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(N=Cc1ccccc1)c1ccccc1 |
|
~91%
1-(benzylidenea... CAS#:52185-06-5 |
| Literature: Nguyen, Thu-Huong; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1383 - 1388 |
|
~%
1-(benzylidenea... CAS#:52185-06-5 |
| Literature: Nguyen, Thu-Huong; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1383 - 1388 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Hydrazinecarboxamide,N-methyl-1-phenyl-2-(phenylmethylene) |