1-benzyl-2,2,6,6-tetramethylpiperidin-4-ol structure
|
Common Name | 1-benzyl-2,2,6,6-tetramethylpiperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 52185-71-4 | Molecular Weight | 247.37600 | |
| Density | 0.99g/cm3 | Boiling Point | 341.9ºC at 760mmHg | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.9ºC | |
| Name | 1-benzyl-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 341.9ºC at 760mmHg |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.37600 |
| Flash Point | 39.9ºC |
| Exact Mass | 247.19400 |
| PSA | 23.47000 |
| LogP | 3.13840 |
| Index of Refraction | 1.521 |
| InChIKey | VLTHAKKFNPUWSB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(O)CC(C)(C)N1Cc1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
1-benzyl-2,2,6,... CAS#:52185-71-4 |
| Literature: Ciba-Geigy Corporation Patent: US4014887 A1, 1977 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| D427 |
| EINECS 257-718-4 |
| 1-Benzyl-2,2,6,6-tetramethyl-4-hydroxypiperidine |