N-(4-bromophenyl)-1-(4-propoxyphenyl)methanimine structure
|
Common Name | N-(4-bromophenyl)-1-(4-propoxyphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 5219-51-2 | Molecular Weight | 318.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-bromophenyl)-1-(4-propoxyphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16BrNO |
|---|---|
| Molecular Weight | 318.20800 |
| Exact Mass | 317.04200 |
| PSA | 21.59000 |
| LogP | 4.98850 |
| InChIKey | VEBDRXZJRHRAKO-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(C=Nc2ccc(Br)cc2)cc1 |
|
~%
N-(4-bromopheny... CAS#:5219-51-2 |
| Literature: Sakagami, Sakumitsu; Nakamizo, Minoru Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 1 p. 265 - 266 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenamine,4-bromo-N-[(4-propoxyphenyl)methylene] |