2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)propanedinitrile structure
|
Common Name | 2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 5219-85-2 | Molecular Weight | 223.27300 | |
| Density | 1.119g/cm3 | Boiling Point | 367.3ºC at 760 mmHg | |
| Molecular Formula | C14H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | 2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 367.3ºC at 760 mmHg |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.27300 |
| Flash Point | 175.9ºC |
| Exact Mass | 223.11100 |
| PSA | 59.61000 |
| LogP | 2.69796 |
| Index of Refraction | 1.559 |
| InChIKey | KXTRQYWNVBFJGJ-UHFFFAOYSA-N |
| SMILES | CC1(C)Cc2ccccc2C(=C(C#N)C#N)N1 |
|
~%
2-(3,3-dimethyl... CAS#:5219-85-2 |
| Literature: Field; Grunwald Journal of the American Chemical Society, 1953 , vol. 75, p. 934,936 |
| hms659n11 |