2-chloromethyl-4-nitrophenyl(N-carbobenzoxy)glycinate structure
|
Common Name | 2-chloromethyl-4-nitrophenyl(N-carbobenzoxy)glycinate | ||
|---|---|---|---|---|
| CAS Number | 52201-24-8 | Molecular Weight | 378.76400 | |
| Density | 1.389g/cm3 | Boiling Point | 597.2ºC at 760mmHg | |
| Molecular Formula | C17H15ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.9ºC | |
| Name | [2-(chloromethyl)-4-nitrophenyl] 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 597.2ºC at 760mmHg |
| Molecular Formula | C17H15ClN2O6 |
| Molecular Weight | 378.76400 |
| Flash Point | 314.9ºC |
| Exact Mass | 378.06200 |
| PSA | 113.94000 |
| LogP | 3.89300 |
| Index of Refraction | 1.598 |
| InChIKey | VDSZSHURQKDPNZ-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)OCc1ccccc1)Oc1ccc([N+](=O)[O-])cc1CCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Cmncg |
| Glycine,N-((phenylmethoxy)carbonyl)-,2-(chloromethyl)-4-nitrophenyl ester |
| 2-Chloromethyl-4-nitrophenyl(N-carbobenzoxy)glycinate |