5-methoxy-1,2-diphenyl-4-propan-2-ylpyrazol-3-one
Modify Date: 2025-08-25 22:38:30
5-methoxy-1,2-diphenyl-4-propan-2-ylpyrazol-3-one structure
|
Common Name | 5-methoxy-1,2-diphenyl-4-propan-2-ylpyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 52213-76-0 | Molecular Weight | 308.37400 | |
| Density | 1.2g/cm3 | Boiling Point | 430.9ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | 5-methoxy-1,2-diphenyl-4-propan-2-ylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760 mmHg |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37400 |
| Flash Point | 214.4ºC |
| Exact Mass | 308.15200 |
| PSA | 36.16000 |
| LogP | 3.76020 |
| Index of Refraction | 1.629 |
| InChIKey | OILJWCNSFRFRGH-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)C)c(=O)n(-c2ccccc2)n1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methoxy-4-isopropyl-1,2-diphenyl-5-pyrazolone |
| 3-Pyrazolin-5-one,1,2-diphenyl-4-isopropyl-3-methoxy |
| 1,2-Diphenyl-4-isopropyl-3-methoxy-3-pyrazolin-5-one |