sodium 3,5-dichlorophenolate structure
|
Common Name | sodium 3,5-dichlorophenolate | ||
|---|---|---|---|---|
| CAS Number | 52214-59-2 | Molecular Weight | 184.98300 | |
| Density | N/A | Boiling Point | 233ºC at 760 mmHg | |
| Molecular Formula | C6H3Cl2NaO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.9ºC | |
| Name | sodium,3,5-dichlorophenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 233ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H3Cl2NaO |
| Molecular Weight | 184.98300 |
| Flash Point | 106.9ºC |
| Exact Mass | 183.94600 |
| PSA | 23.06000 |
| LogP | 3.13720 |
| InChIKey | GMNRNYDRORPJRI-UHFFFAOYSA-M |
| SMILES | [Na+].[O-]c1cc(Cl)cc(Cl)c1 |
| HS Code | 2908199090 |
|---|
|
~%
sodium 3,5-dich... CAS#:52214-59-2 |
| Literature: Redondo, Jordi; Sanchez-Ferrando, Francisco; Valls, Montserrat; Virgili, Albert Magnetic Resonance in Chemistry, 1988 , vol. 26, p. 511 - 517 |
|
~%
sodium 3,5-dich... CAS#:52214-59-2 |
| Literature: Rowe, Jeffrey E. Australian Journal of Chemistry, 1983 , vol. 36, # 6 p. 1259 - 1262 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Sodium 3,5-dichlorophenolate |
| 3,5-Dichlorophenol sodium salt |
| EINECS 257-742-5 |
| Phenol,3,5-dichloro-,sodium salt (1:1) |