1-amino-2-bromo-4-(3-chloroanilino)anthraquinone
Modify Date: 2025-09-17 11:28:51
1-amino-2-bromo-4-(3-chloroanilino)anthraquinone structure
|
Common Name | 1-amino-2-bromo-4-(3-chloroanilino)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 52222-30-7 | Molecular Weight | 427.67800 | |
| Density | 1.673g/cm3 | Boiling Point | 597.5ºC at 760mmHg | |
| Molecular Formula | C20H12BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.2ºC | |
| Name | 1-amino-2-bromo-4-(3-chloroanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.673g/cm3 |
|---|---|
| Boiling Point | 597.5ºC at 760mmHg |
| Molecular Formula | C20H12BrClN2O2 |
| Molecular Weight | 427.67800 |
| Flash Point | 315.2ºC |
| Exact Mass | 425.97700 |
| PSA | 72.19000 |
| LogP | 5.85790 |
| Index of Refraction | 1.757 |
| InChIKey | MHCBWGDHCLKTPC-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Nc2cccc(Cl)c2)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-2-bromo-4-(3-chloroanilino)anthraquinone |
| Anthraquinone,1-amino-2-bromo-4-m-chloroanilino-(6CI) |
| EINECS 257-754-0 |
| 1-amino-2-bromo-4-[(3-chlorophenyl)amino]-9,10-anthraquinone |