4-O-benzoyl pyridoxine structure
|
Common Name | 4-O-benzoyl pyridoxine | ||
|---|---|---|---|---|
| CAS Number | 5223-10-9 | Molecular Weight | 273.28400 | |
| Density | 1.302g/cm3 | Boiling Point | 536.1ºC at 760mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278ºC | |
| Name | [3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-4-yl]methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 536.1ºC at 760mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 278ºC |
| Exact Mass | 273.10000 |
| PSA | 79.65000 |
| LogP | 1.94490 |
| Index of Refraction | 1.62 |
| InChIKey | VYPDKSKLULNJPO-UHFFFAOYSA-N |
| SMILES | Cc1ncc(CO)c(COC(=O)c2ccccc2)c1O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4-pyridinedimethanol,5-hydroxy-6-methyl-,|A4-benzoate |
| 3,4-Pyridinedimethanol,5-hydroxy-6-methyl-,alpha4-benzoate |
| 4-O-Benzoyl pyridoxine |
| Pyridoxine 4-benzoic acid ester |