bis(3-methoxybutyl) peroxydicarbonate
Modify Date: 2025-08-25 17:02:08
bis(3-methoxybutyl) peroxydicarbonate structure
|
Common Name | bis(3-methoxybutyl) peroxydicarbonate | ||
|---|---|---|---|---|
| CAS Number | 52238-68-3 | Molecular Weight | 294.29800 | |
| Density | 1.132g/cm3 | Boiling Point | 328ºC at 760mmHg | |
| Molecular Formula | C12H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | bis(3-methoxybutyl) peroxydicarbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 328ºC at 760mmHg |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.29800 |
| Flash Point | 139.1ºC |
| Exact Mass | 294.13100 |
| PSA | 89.52000 |
| LogP | 2.05780 |
| Index of Refraction | 1.437 |
| InChIKey | FBQZJBMRDNLFQO-UHFFFAOYSA-N |
| SMILES | COC(C)CCOOC(=O)C(=O)OOCCC(C)OC |
| HS Code | 2909600000 |
|---|
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Peroxydicarbonic acid,bis(3-methoxybutyl)ester |
| Peroxybis(formic acid 3-methoxybutyl) ester |
| Einecs 257-773-4 |
| Di-3-methoxybutyl peroxy dicarbonate |
| Peroxydicarbonic acid di(3-methoxybutyl) ester |