3-ethyl-2-ethylsulfanyl-1,3-benzothiazol-3-ium,4-methylbenzenesulfonate structure
|
Common Name | 3-ethyl-2-ethylsulfanyl-1,3-benzothiazol-3-ium,4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 5231-22-1 | Molecular Weight | 395.55900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO3S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-2-ethylsulfanyl-1,3-benzothiazol-3-ium,4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21NO3S3 |
|---|---|
| Molecular Weight | 395.55900 |
| Exact Mass | 395.06800 |
| PSA | 123.00000 |
| LogP | 5.30060 |
| InChIKey | KGWPDEXNWSCONX-UHFFFAOYSA-M |
| SMILES | CCSc1sc2ccccc2[n+]1CC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| HS Code | 2934999090 |
|---|
|
~%
3-ethyl-2-ethyl... CAS#:5231-22-1 |
| Literature: Fry; Kendall Journal of the Chemical Society, 1951 , p. 1723,1725 |
|
~%
3-ethyl-2-ethyl... CAS#:5231-22-1 |
| Literature: Fry; Kendall Journal of the Chemical Society, 1951 , p. 1723,1725 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzothiazolium,3-ethyl-2-(ethylthio)-,4-methylbenzenesulfonate (1:1) |