N-[(cyclobutyl-phenyl-methylidene)amino]-2,4-dinitro-aniline structure
|
Common Name | N-[(cyclobutyl-phenyl-methylidene)amino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 5231-85-6 | Molecular Weight | 340.33300 | |
| Density | 1.41g/cm3 | Boiling Point | 501.9ºC at 760 mmHg | |
| Molecular Formula | C17H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3ºC | |
| Name | N-[[cyclobutyl(phenyl)methylidene]amino]-2,4-dinitroaniline |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 501.9ºC at 760 mmHg |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.33300 |
| Flash Point | 257.3ºC |
| Exact Mass | 340.11700 |
| PSA | 116.03000 |
| LogP | 5.23870 |
| Index of Refraction | 1.676 |
| InChIKey | OBSPPIQPIWIHDJ-HTXNQAPBSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C(c2ccccc2)C2CCC2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |