5-Chloro-3, 4-dihydro-2H-1, 2,4-benzothiazide-7-sulfonamide-1,1-dioxide
Modify Date: 2025-08-20 12:35:05
5-Chloro-3, 4-dihydro-2H-1, 2,4-benzothiazide-7-sulfonamide-1,1-dioxide structure
|
Common Name | 5-Chloro-3, 4-dihydro-2H-1, 2,4-benzothiazide-7-sulfonamide-1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5233-42-1 | Molecular Weight | 332.18400 | |
| Density | 1.546g/cm3 | Boiling Point | 720.3ºC at 760 mmHg | |
| Molecular Formula | C7H7Cl2N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.4ºC | |
| Name | 5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 720.3ºC at 760 mmHg |
| Molecular Formula | C7H7Cl2N3O4S2 |
| Molecular Weight | 332.18400 |
| Flash Point | 389.4ºC |
| Exact Mass | 330.92600 |
| PSA | 135.12000 |
| LogP | 3.63080 |
| Index of Refraction | 1.711 |
| InChIKey | BSNKBIJVLZUERH-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(c(Cl)c1Cl)NCNS2(=O)=O |
| HS Code | 2935009090 |
|---|
|
~%
5-Chloro-3, 4-d... CAS#:5233-42-1 |
| Literature: Short,J.H.; Biermacher,U. Journal of the American Chemical Society, 1960 , vol. 82, p. 1135 - 1138 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 5-Chloro Hydrochlorothiazide |
| 5,6-Dichloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-Dioxide |
| 5,6-dichloro-1,1-dioxo-3,4-dihydro-2H-1 |
| 5,6-Dichloro-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine-1,1-dioxide |
| UNII-VZ0VQ8J83H |
| 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 5,6-dichloro-3,4-dihydro-, 1,1-dioxide |
| 5,6-Dichloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
| 5-Chloro-3, 4-dihydro-2H-1, 2,4-benzothiazide-7-sulfonamide-1,1-dioxide |
| Hydrochlorothiazide Impurity 1 |