4-Aminophenylphosphate structure
|
Common Name | 4-Aminophenylphosphate | ||
|---|---|---|---|---|
| CAS Number | 52331-30-3 | Molecular Weight | 211.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7NNaO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-phosphonatoaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7NNaO4P |
|---|---|
| Molecular Weight | 211.08800 |
| Exact Mass | 211.00100 |
| PSA | 105.42000 |
| LogP | 1.75970 |
| InChIKey | OAOBMEMWHJWPNA-UHFFFAOYSA-L |
| SMILES | Nc1ccc(P(=O)([O-])[O-])cc1 |
| HS Code | 2922199090 |
|---|
|
~%
4-Aminophenylph... CAS#:52331-30-3 |
| Literature: Deprez, Pierre; Mandine, Eliane; Gofflo, Dominique; Meunier, Stephane; Lesuisse, Dominique Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 9 p. 1295 - 1298 |
|
~%
4-Aminophenylph... CAS#:52331-30-3 |
| Literature: Boyland; Manson Journal of the Chemical Society, 1957 , p. 4689,4691,4692 |
|
~%
4-Aminophenylph... CAS#:52331-30-3 |
| Literature: Boyland; Manson Journal of the Chemical Society, 1957 , p. 4689,4691,4692 |
|
~%
4-Aminophenylph... CAS#:52331-30-3
Detail
|
| Literature: Boyland; Manson Journal of the Chemical Society, 1957 , p. 4689,4691,4692 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Aminophenyl phosphate |
| Phenol,4-amino-,dihydrogen phosphate (ester) (9CI) |
| phosphoric acid mono-(4-amino-phenyl ester) |
| para-aminophenyl phosphoric acid |
| Phosphorsaeure-mono-(4-amino-phenylester) |
| p-Anilinphosphat |
| Phenol,4-amino-,1-(dihydrogen phosphate) |
| Phenol,p-amino-,phosphate(7CI) |
| p-Aminophenyl dihydrogen phosphate |
| p-Amino-phenol-monophosphat |
| 4-Aminophenyl dihydrogen phosphate |
| 4-AMINOPHENYLPHOSPHONATE |
| 4-Aminophenyl phosphate |