16-phenyl tetranor Prostaglandin E1 (16-phenyl tetranor PGE1) structure
|
Common Name | 16-phenyl tetranor Prostaglandin E1 (16-phenyl tetranor PGE1) | ||
|---|---|---|---|---|
| CAS Number | 52344-27-1 | Molecular Weight | 374.471 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 575.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.8±26.6 °C | |
Use of 16-phenyl tetranor Prostaglandin E1 (16-phenyl tetranor PGE1)16-phenyl tetranor PGE1 is a metabolically stable synthetic PGE1 analog. |
| Name | 16-phenyl tetranor Prostaglandin E1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.3±50.0 °C at 760 mmHg |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.471 |
| Flash Point | 315.8±26.6 °C |
| Exact Mass | 374.209320 |
| PSA | 94.83000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | WDKPQDFHBMGHOW-ABXFKLLGSA-N |
| SMILES | O=C(O)CCCCCCC1C(=O)CC(O)C1C=CC(O)Cc1ccccc1 |
| 7-{(2R)-3-Hydroxy-2-[(1E)-3-hydroxy-4-phenyl-1-buten-1-yl]-5-oxocyclopentyl}heptanoic acid |
| Cyclopentaneheptanoic acid, 3-hydroxy-2-[(1E)-3-hydroxy-4-phenyl-1-buten-1-yl]-5-oxo-, (2R)- |