Iproxamine structure
|
Common Name | Iproxamine | ||
|---|---|---|---|---|
| CAS Number | 52403-19-7 | Molecular Weight | 323.42700 | |
| Density | 1.03g/cm3 | Boiling Point | 420.5ºC at 760 mmHg | |
| Molecular Formula | C18H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] propan-2-yl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760 mmHg |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.42700 |
| Flash Point | 208.1ºC |
| Exact Mass | 323.21000 |
| PSA | 48.00000 |
| LogP | 3.98260 |
| Index of Refraction | 1.497 |
| InChIKey | JBWWCPMFTSBPAK-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCCN(C)C)c(C(C)C)cc1OC(=O)OC(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[2-(dimethylamino)ethoxy]-2-methyl-5-(propan-2-yl)phenyl propan-2-yl carbonate |
| Iproxamine [INN] |
| [4-(2-dimethylaminoethyloxy)-2-methyl-5-propan-2-ylphenyl] propan-2-yl carbonate |
| UNII-URR853YLZA |
| IPROXAMINE |