1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene
![1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene Structure](https://image.chemsrc.com/caspic/241/52411-04-8.png)
1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene structure
|
Common Name | 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene | ||
|---|---|---|---|---|
| CAS Number | 52411-04-8 | Molecular Weight | 368.46600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H28O4 |
|---|---|
| Molecular Weight | 368.46600 |
| Exact Mass | 368.19900 |
| PSA | 36.92000 |
| LogP | 5.09030 |
| InChIKey | BEWFATAMCWSJRR-UHFFFAOYSA-N |
| SMILES | C=COCCOc1ccc(C(C)(C)c2ccc(OCCOC=C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
1-(2-ethenoxyet... CAS#:52411-04-8 |
| Literature: Gallucci, R.R.; Going, R.C. Journal of Organic Chemistry, 1983 , vol. 48, # 3 p. 342 - 346 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1,1'-(1-methylethylidene)bis[4-[2-(ethenyloxy)ethoxy] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: CAS number of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is 52411-04-8. |
| Q: What is the LogP of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: LogP of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is 5.09030. |
| Q: What is the InChIKey of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: InChIKey of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is BEWFATAMCWSJRR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: Related upstream materials(CAS) of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene: 80-05-7;110-75-8. |
| Q: What is the Chinese name of 52411-04-8? |
| A: Chinese name of 52411-04-8 is 52411-04-8. |
| Q: What is the English name of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: The English name of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene. |
| Q: What is the SMILES notation of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: SMILES notation of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is C=COCCOc1ccc(C(C)(C)c2ccc(OCCOC=C)cc2)cc1. |
| Q: What is the polar surface area (PSA) of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: Polar surface area (PSA) of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is 36.92000. |
| Q: What is the molecular formula of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: Molecular formula of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is C23H28O4. |
| Q: What is the molecular weight of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene? |
| A: Molecular weight of 1-(2-ethenoxyethoxy)-4-[2-[4-(2-ethenoxyethoxy)phenyl]propan-2-yl]benzene is 368.46600. |