6,7-diamino-2,3-dihydrophthalazine-1,4-dione structure
|
Common Name | 6,7-diamino-2,3-dihydrophthalazine-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 52412-81-4 | Molecular Weight | 192.17500 | |
| Density | 1.526g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-diamino-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.17500 |
| Exact Mass | 192.06500 |
| PSA | 118.28000 |
| LogP | 1.36780 |
| InChIKey | CYMWNBRHNRVFCF-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(=O)[nH][nH]c(=O)c2cc1N |
| HS Code | 2933990090 |
|---|
|
~%
6,7-diamino-2,3... CAS#:52412-81-4 |
| Literature: Drew; Pearman Journal of the Chemical Society, 1937 , p. 586,590 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Diaminophthalhydrazide |
| 1,4-Phthalazinedione,6,7-diamino-2,3-dihydro |
| 4,5-Dph |