N-(2-acetyl-4-methoxyphenyl)acetamide structure
|
Common Name | N-(2-acetyl-4-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 52417-34-2 | Molecular Weight | 207.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-acetyl-4-methoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3 |
|---|---|
| Molecular Weight | 207.22600 |
| Exact Mass | 207.09000 |
| PSA | 58.89000 |
| LogP | 2.50570 |
| InChIKey | RHQCJXHCQABOJR-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(C)=O)c(C(C)=O)c1 |
|
~87%
N-(2-acetyl-4-m... CAS#:52417-34-2 |
| Literature: Takemoto, Masumi; Iwakiri, Yasutaka; Tanaka, Kiyoshi Heterocycles, 2007 , vol. 72, p. 373 - 383 |
|
~%
N-(2-acetyl-4-m... CAS#:52417-34-2 |
| Literature: Beer et al. Journal of the Chemical Society, 1954 , p. 4139,4141 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Acetamide,N-(2-acetyl-4-methoxyphenyl) |